C10H17N3O2 — CID 86330831
tert-butyl (3R)-3-amino-3-cyanopyrrolidine-1-carboxylate (PubChem CID 86330831) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is tert-butyl (3R)-3-amino-3-cyanopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-amino-3-cyanopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86330831 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | tert-butyl (3R)-3-amino-3-cyanopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](N)(C#N)C1 |
| InChI | InChI=1S/C10H17N3O2/c1-9(2,3)15-8(14)13-5-4-10(12,6-11)7-13/h4-5,7,12H2,1-3H3/t10-/m0/s1 |
| InChIKey | NFLVTBMZGLRSPT-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |