C23H28N2O5 — CID 126742922
tert-butyl 4-cyano-4-[4-[(E)-4-ethoxy-3,4-dioxobut-1-enyl]phenyl]piperidine-1-carboxylate (PubChem CID 126742922) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-[4-[(E)-4-ethoxy-3,4-dioxobut-1-enyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-[4-[(E)-4-ethoxy-3,4-dioxobut-1-enyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126742922 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl 4-cyano-4-[4-[(E)-4-ethoxy-3,4-dioxobut-1-enyl]phenyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(=O)/C=C/c1ccc(C2(C#N)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-5-29-20(27)19(26)11-8-17-6-9-18(10-7-17)23(16-24)12-14-25(15-13-23)21(28)30-22(2,3)4/h6-11H,5,12-15H2,1-4H3/b11-8+ |
| InChIKey | MRSUBOMCTYQAGN-DHZHZOJOSA-N |
| XLogP | 3.62 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|