C17H20F2N2O2 — CID 156587453
tert-butyl 4-cyano-4-(3,5-difluorophenyl)piperidine-1-carboxylate (PubChem CID 156587453) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-(3,5-difluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-(3,5-difluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156587453 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | tert-butyl 4-cyano-4-(3,5-difluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-16(2,3)23-15(22)21-6-4-17(11-20,5-7-21)12-8-13(18)10-14(19)9-12/h8-10H,4-7H2,1-3H3 |
| InChIKey | ZVZGGSUEEYUFHV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |