C17H21FN4O3 — CID 59322301
tert-butyl 4-cyano-4-[(5-fluoro-2-pyridinyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 59322301) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-[(5-fluoro-2-pyridinyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-[(5-fluoro-2-pyridinyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59322301 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl 4-cyano-4-[(5-fluoro-2-pyridinyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)(C(=O)Nc2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C17H21FN4O3/c1-16(2,3)25-15(24)22-8-6-17(11-19,7-9-22)14(23)21-13-5-4-12(18)10-20-13/h4-5,10H,6-9H2,1-3H3,(H,20,21,23) |
| InChIKey | OCMGBASSIMXGSC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |