C18H28N4O3 — CID 59322318
tert-butyl 4-(aminomethyl)-4-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 59322318) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)-4-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(aminomethyl)-4-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59322318 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | tert-butyl 4-(aminomethyl)-4-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2(CN)CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C18H28N4O3/c1-13-5-6-14(20-11-13)21-15(23)18(12-19)7-9-22(10-8-18)16(24)25-17(2,3)4/h5-6,11H,7-10,12,19H2,1-4H3,(H,20,21,23) |
| InChIKey | ITIOEQAYHXMTOJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |