C19H30N6O3 — CID 111093098
tert-butyl 4-[N'-[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111093098) has the molecular formula C19H30N6O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is tert-butyl 4-[N'-[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111093098 |
| Molecular Formula | C19H30N6O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl 4-[N'-[3-[(5-methyl-2-pyridinyl)amino]-3-oxopropyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)CC/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C19H30N6O3/c1-14-5-6-15(22-13-14)23-16(26)7-8-21-17(20)24-9-11-25(12-10-24)18(27)28-19(2,3)4/h5-6,13H,7-12H2,1-4H3,(H2,20,21)(H,22,23,26) |
| InChIKey | WLTRUDLMYATZFW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|