C16H21BrFN3O3 — CID 134418918
tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 134418918) has the molecular formula C16H21BrFN3O3 and a molecular weight of 402.26 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134418918 |
| Molecular Formula | C16H21BrFN3O3 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | tert-butyl (3R)-3-[(5-bromo-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](F)(C(=O)Nc2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C16H21BrFN3O3/c1-15(2,3)24-14(23)21-8-4-7-16(18,10-21)13(22)20-12-6-5-11(17)9-19-12/h5-6,9H,4,7-8,10H2,1-3H3,(H,19,20,22)/t16-/m1/s1 |
| InChIKey | FJJBUIWTLHHECZ-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |