C18H23BrFN3O4 — CID 151994953
tert-butyl 4-[(4-bromo-2-carbamoylphenyl)carbamoyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 151994953) has the molecular formula C18H23BrFN3O4 and a molecular weight of 444.30 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromo-2-carbamoylphenyl)carbamoyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromo-2-carbamoylphenyl)carbamoyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 151994953 |
| Molecular Formula | C18H23BrFN3O4 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | tert-butyl 4-[(4-bromo-2-carbamoylphenyl)carbamoyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(C(=O)Nc2ccc(Br)cc2C(N)=O)CC1 |
| InChI | InChI=1S/C18H23BrFN3O4/c1-17(2,3)27-16(26)23-8-6-18(20,7-9-23)15(25)22-13-5-4-11(19)10-12(13)14(21)24/h4-5,10H,6-9H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | UFLWCVTUJBXWPX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |