C22H27FN4O3 — CID 139301687
tert-butyl 3-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 139301687) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is tert-butyl 3-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139301687 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | tert-butyl 3-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(C(=O)Nc2nc(-c3ccccc3)ccc2N)C1 |
| InChI | InChI=1S/C22H27FN4O3/c1-21(2,3)30-20(29)27-13-7-12-22(23,14-27)19(28)26-18-16(24)10-11-17(25-18)15-8-5-4-6-9-15/h4-6,8-11H,7,12-14,24H2,1-3H3,(H,25,26,28) |
| InChIKey | KAXGQUPGGVJKKX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |