C21H32BFN4O5 — CID 142318569
tert-butyl 3-fluoro-3-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 142318569) has the molecular formula C21H32BFN4O5 and a molecular weight of 450.32 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142318569 |
| Molecular Formula | C21H32BFN4O5 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | tert-butyl 3-fluoro-3-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(C(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)nn2)C1 |
| InChI | InChI=1S/C21H32BFN4O5/c1-18(2,3)30-17(29)27-12-8-11-21(23,13-27)16(28)24-15-10-9-14(25-26-15)22-31-19(4,5)20(6,7)32-22/h9-10H,8,11-13H2,1-7H3,(H,24,26,28) |
| InChIKey | RGBPGCGQIPBLEJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|