C23H35BN4O5 — CID 163301591
tert-butyl (4R)-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]oxyazepane-1-carboxylate (PubChem CID 163301591) has the molecular formula C23H35BN4O5 and a molecular weight of 458.37 g/mol. Its IUPAC name is tert-butyl (4R)-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]oxyazepane-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]oxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 163301591 |
| Molecular Formula | C23H35BN4O5 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | tert-butyl (4R)-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrazin-4-yl]oxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Oc2nc(B3OC(C)(C)C(C)(C)O3)cn3nccc23)CC1 |
| InChI | InChI=1S/C23H35BN4O5/c1-21(2,3)31-20(29)27-13-8-9-16(11-14-27)30-19-17-10-12-25-28(17)15-18(26-19)24-32-22(4,5)23(6,7)33-24/h10,12,15-16H,8-9,11,13-14H2,1-7H3/t16-/m1/s1 |
| InChIKey | KOBPZLKGOHTVNO-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|