C20H34BN3O4 — CID 154791970
tert-butyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 154791970) has the molecular formula C20H34BN3O4 and a molecular weight of 391.32 g/mol. Its IUPAC name is tert-butyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154791970 |
| Molecular Formula | C20H34BN3O4 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | tert-butyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2ccc(B3OC(C)(C)C(C)(C)O3)n2)CC1 |
| InChI | InChI=1S/C20H34BN3O4/c1-18(2,3)26-17(25)23-11-8-15(9-12-23)14-24-13-10-16(22-24)21-27-19(4,5)20(6,7)28-21/h10,13,15H,8-9,11-12,14H2,1-7H3 |
| InChIKey | WTYMFEBWTWHESP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|