C24H37BN2O6 — CID 10344222
tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyloxymethyl]piperidine-1-carboxylate (PubChem CID 10344222) has the molecular formula C24H37BN2O6 and a molecular weight of 460.38 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyloxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyloxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10344222 |
| Molecular Formula | C24H37BN2O6 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | tert-butyl 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyloxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COC(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C24H37BN2O6/c1-22(2,3)31-21(29)27-14-12-17(13-15-27)16-30-20(28)26-19-10-8-18(9-11-19)25-32-23(4,5)24(6,7)33-25/h8-11,17H,12-16H2,1-7H3,(H,26,28) |
| InChIKey | AXEASNWABHUONG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|