C33H47BN2O5 — CID 68796604
tert-butyl 4-[2-methyl-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoylamino]phenyl]piperidine-1-carboxylate (PubChem CID 68796604) has the molecular formula C33H47BN2O5 and a molecular weight of 562.56 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoylamino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoylamino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68796604 |
| Molecular Formula | C33H47BN2O5 |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | tert-butyl 4-[2-methyl-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butanoylamino]phenyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)CCCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H47BN2O5/c1-23-12-17-27(22-28(23)25-18-20-36(21-19-25)30(38)39-31(2,3)4)35-29(37)11-9-10-24-13-15-26(16-14-24)34-40-32(5,6)33(7,8)41-34/h12-17,22,25H,9-11,18-21H2,1-8H3,(H,35,37) |
| InChIKey | UUUAXKOCOJWZLJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|