C27H35IN2O4 — CID 68799750
tert-butyl 4-[5-[4-(4-iodophenoxy)butanoylamino]-2-methylphenyl]piperidine-1-carboxylate (PubChem CID 68799750) has the molecular formula C27H35IN2O4 and a molecular weight of 578.49 g/mol. Its IUPAC name is tert-butyl 4-[5-[4-(4-iodophenoxy)butanoylamino]-2-methylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[4-(4-iodophenoxy)butanoylamino]-2-methylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68799750 |
| Molecular Formula | C27H35IN2O4 |
| Molecular Weight | 578.49 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | tert-butyl 4-[5-[4-(4-iodophenoxy)butanoylamino]-2-methylphenyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)CCCOc2ccc(I)cc2)cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H35IN2O4/c1-19-7-10-22(29-25(31)6-5-17-33-23-11-8-21(28)9-12-23)18-24(19)20-13-15-30(16-14-20)26(32)34-27(2,3)4/h7-12,18,20H,5-6,13-17H2,1-4H3,(H,29,31) |
| InChIKey | JCMJAEGSQAJLBR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|