C18H27IN2O2 — CID 103730154
tert-butyl 4-[(3-iodo-4-methylanilino)methyl]piperidine-1-carboxylate (PubChem CID 103730154) has the molecular formula C18H27IN2O2 and a molecular weight of 430.33 g/mol. Its IUPAC name is tert-butyl 4-[(3-iodo-4-methylanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-iodo-4-methylanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103730154 |
| Molecular Formula | C18H27IN2O2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | tert-butyl 4-[(3-iodo-4-methylanilino)methyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(NCC2CCN(C(=O)OC(C)(C)C)CC2)cc1I |
| InChI | InChI=1S/C18H27IN2O2/c1-13-5-6-15(11-16(13)19)20-12-14-7-9-21(10-8-14)17(22)23-18(2,3)4/h5-6,11,14,20H,7-10,12H2,1-4H3 |
| InChIKey | PIIWZXXXQAJCQG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|