C18H25N3O3 — CID 169354641
tert-butyl 4-[(4-isocyanatoanilino)methyl]piperidine-1-carboxylate (PubChem CID 169354641) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl 4-[(4-isocyanatoanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-isocyanatoanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169354641 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | tert-butyl 4-[(4-isocyanatoanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2ccc(N=C=O)cc2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,3)24-17(23)21-10-8-14(9-11-21)12-19-15-4-6-16(7-5-15)20-13-22/h4-7,14,19H,8-12H2,1-3H3 |
| InChIKey | IFVSHIPMLWZEIM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|