C16H20N2O3 — CID 169354113
tert-butyl 7-isocyanato-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 169354113) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 7-isocyanato-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 7-isocyanato-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 169354113 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 7-isocyanato-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(N=C=O)cc2CC1 |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,3)21-15(20)18-8-6-12-4-5-14(17-11-19)10-13(12)7-9-18/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | YZIHVEBLCZZNQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|