C15H22N2O2 — CID 11402789
tert-butyl 7-amino-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 11402789) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is tert-butyl 7-amino-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 7-amino-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 11402789 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | tert-butyl 7-amino-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(N)cc2CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2,3)19-14(18)17-8-6-11-4-5-13(16)10-12(11)7-9-17/h4-5,10H,6-9,16H2,1-3H3 |
| InChIKey | PNIRXSPRJRSPJH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|