About tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate
tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate (PubChem CID 129390096) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate |
| PubChem CID | 129390096 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H]2Cc3ccc(N)cc3C2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-18(2,3)23-17(22)21-8-6-20(7-9-21)16-11-13-4-5-15(19)10-14(13)12-16/h4-5,10,16H,6-9,11-12,19H2,1-3H3/t16-/m0/s1 |
| InChIKey | ZSKAITCFCCLVSW-INIZCTEOSA-N |
| XLogP | 2.29 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate (CID 129390096) is tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN([C@H]2Cc3ccc(N)cc3C2)CC1.
What is the InChIKey of tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate?
The InChIKey is ZSKAITCFCCLVSW-INIZCTEOSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-18(2,3)23-17(22)21-8-6-20(7-9-21)16-11-13-4-5-15(19)10-14(13)12-16/h4-5,10,16H,6-9,11-12,19H2,1-3H3/t16-/m0/s1.
What are the key properties of tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate?
tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate has a molecular weight of 317.43 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]piperazine-1-carboxylate is sourced from PubChem (CID 129390096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).