C15H24N4O4S — CID 58901777
tert-butyl 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 58901777) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is tert-butyl 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58901777 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C15H24N4O4S/c1-15(2,3)23-14(20)18-6-8-19(9-7-18)24(21,22)13-5-4-11(16)10-12(13)17/h4-5,10H,6-9,16-17H2,1-3H3 |
| InChIKey | XHBFYOCXIRHBMP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|