C11H16N4O4S — CID 69446701
4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylic acid (PubChem CID 69446701) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylic acid.
| Compound Name | 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69446701 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-(2,4-diaminophenyl)sulfonylpiperazine-1-carboxylic acid |
| SMILES | Nc1ccc(S(=O)(=O)N2CCN(C(=O)O)CC2)c(N)c1 |
| InChI | InChI=1S/C11H16N4O4S/c12-8-1-2-10(9(13)7-8)20(18,19)15-5-3-14(4-6-15)11(16)17/h1-2,7H,3-6,12-13H2,(H,16,17) |
| InChIKey | KOHXNYKIEYDQGL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|