C17H26N4O3S2 — CID 154370003
4-(2-acetyl-4-aminophenyl)sulfonyl-N,N-diethylpiperazine-1-carbothioamide (PubChem CID 154370003) has the molecular formula C17H26N4O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 4-(2-acetyl-4-aminophenyl)sulfonyl-N,N-diethylpiperazine-1-carbothioamide.
| Compound Name | 4-(2-acetyl-4-aminophenyl)sulfonyl-N,N-diethylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 154370003 |
| Molecular Formula | C17H26N4O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-(2-acetyl-4-aminophenyl)sulfonyl-N,N-diethylpiperazine-1-carbothioamide |
| SMILES | CCN(CC)C(=S)N1CCN(S(=O)(=O)c2ccc(N)cc2C(C)=O)CC1 |
| InChI | InChI=1S/C17H26N4O3S2/c1-4-19(5-2)17(25)20-8-10-21(11-9-20)26(23,24)16-7-6-14(18)12-15(16)13(3)22/h6-7,12H,4-5,8-11,18H2,1-3H3 |
| InChIKey | FSKCBIURNRAJGH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|