C12H19N3O4S2 — CID 61126173
3-methyl-4-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline (PubChem CID 61126173) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-methyl-4-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 3-methyl-4-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 61126173 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-methyl-4-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-10-9-11(13)3-4-12(10)21(18,19)15-7-5-14(6-8-15)20(2,16)17/h3-4,9H,5-8,13H2,1-2H3 |
| InChIKey | IXTSLVVDVHEYID-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|