C11H16ClN3O4S2 — CID 61126558
4-chloro-2-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline (PubChem CID 61126558) has the molecular formula C11H16ClN3O4S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 4-chloro-2-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 4-chloro-2-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 61126558 |
| Molecular Formula | C11H16ClN3O4S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-chloro-2-(4-methylsulfonylpiperazin-1-yl)sulfonylaniline |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2N)CC1 |
| InChI | InChI=1S/C11H16ClN3O4S2/c1-20(16,17)14-4-6-15(7-5-14)21(18,19)11-8-9(12)2-3-10(11)13/h2-3,8H,4-7,13H2,1H3 |
| InChIKey | MPFUTNIJUHUHER-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|