C15H21ClN2O2S — CID 114459734
2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4-chloroaniline (PubChem CID 114459734) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4-chloroaniline.
| Compound Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4-chloroaniline |
|---|---|
| PubChem CID | 114459734 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4-chloroaniline |
| SMILES | CC(C)(C)C1=CCN(S(=O)(=O)c2cc(Cl)ccc2N)CC1 |
| InChI | InChI=1S/C15H21ClN2O2S/c1-15(2,3)11-6-8-18(9-7-11)21(19,20)14-10-12(16)4-5-13(14)17/h4-6,10H,7-9,17H2,1-3H3 |
| InChIKey | MWAKEYYUXUMVDW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|