C14H21NO4S — CID 114460972
[5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]furan-2-yl]methanol (PubChem CID 114460972) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is [5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]furan-2-yl]methanol.
| Compound Name | [5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 114460972 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]furan-2-yl]methanol |
| SMILES | CC(C)(C)C1=CCN(S(=O)(=O)c2ccc(CO)o2)CC1 |
| InChI | InChI=1S/C14H21NO4S/c1-14(2,3)11-6-8-15(9-7-11)20(17,18)13-5-4-12(10-16)19-13/h4-6,16H,7-10H2,1-3H3 |
| InChIKey | XNKIVPMYTCFARE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|