C12H21NO4S — CID 114459831
2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanoic acid (PubChem CID 114459831) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanoic acid.
| Compound Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanoic acid |
|---|---|
| PubChem CID | 114459831 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H21NO4S/c1-9(11(14)15)18(16,17)13-7-5-10(6-8-13)12(2,3)4/h5,9H,6-8H2,1-4H3,(H,14,15) |
| InChIKey | RDGIYEHXMSOYFW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|