C14H19NO4S2 — CID 114459835
3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylic acid (PubChem CID 114459835) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114459835 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)C1=CCN(S(=O)(=O)c2ccsc2C(=O)O)CC1 |
| InChI | InChI=1S/C14H19NO4S2/c1-14(2,3)10-4-7-15(8-5-10)21(18,19)11-6-9-20-12(11)13(16)17/h4,6,9H,5,7-8H2,1-3H3,(H,16,17) |
| InChIKey | XVBFBDTTXQPRMY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|