C13H20N2O2S2 — CID 114459728
5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-3-amine (PubChem CID 114459728) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-3-amine.
| Compound Name | 5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-3-amine |
|---|---|
| PubChem CID | 114459728 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-3-amine |
| SMILES | CC(C)(C)C1=CCN(S(=O)(=O)c2cc(N)cs2)CC1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-13(2,3)10-4-6-15(7-5-10)19(16,17)12-8-11(14)9-18-12/h4,8-9H,5-7,14H2,1-3H3 |
| InChIKey | WZWUDMMWHPMVHE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|