C12H22N2O — CID 115774578
4-tert-butyl-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 115774578) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-tert-butyl-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 115774578 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-tert-butyl-N,N-dimethyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-12(2,3)10-6-8-14(9-7-10)11(15)13(4)5/h6H,7-9H2,1-5H3 |
| InChIKey | WYZFZZDWKGSKBT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|