C12H18F3NO — CID 121450240
1-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3,3,3-trifluoropropan-1-one (PubChem CID 121450240) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 121450240 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3,3,3-trifluoropropan-1-one |
| SMILES | CC(C)(C)C1=CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F3NO/c1-11(2,3)9-4-6-16(7-5-9)10(17)8-12(13,14)15/h4H,5-8H2,1-3H3 |
| InChIKey | AZORWNDEOSCYAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|