C8H9BrF3NO — CID 114489735
2-bromo-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 114489735) has the molecular formula C8H9BrF3NO and a molecular weight of 272.06 g/mol. Its IUPAC name is 2-bromo-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 2-bromo-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 114489735 |
| Molecular Formula | C8H9BrF3NO |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-bromo-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | O=C(CBr)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H9BrF3NO/c9-5-7(14)13-3-1-6(2-4-13)8(10,11)12/h1H,2-5H2 |
| InChIKey | ATTMSXPIRNGGSN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|