C13H24N2O — CID 115774734
4-tert-butyl-N-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 115774734) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 4-tert-butyl-N-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 115774734 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 4-tert-butyl-N-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O/c1-10(2)14-12(16)15-8-6-11(7-9-15)13(3,4)5/h6,10H,7-9H2,1-5H3,(H,14,16) |
| InChIKey | GEYLRBSVDRKOHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|