C16H28N2O3 — CID 114460562
5-[(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]hexanoic acid (PubChem CID 114460562) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-[(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]hexanoic acid.
| Compound Name | 5-[(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 114460562 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 5-[(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]hexanoic acid |
| SMILES | CC(CCCC(=O)O)NC(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O3/c1-12(6-5-7-14(19)20)17-15(21)18-10-8-13(9-11-18)16(2,3)4/h8,12H,5-7,9-11H2,1-4H3,(H,17,21)(H,19,20) |
| InChIKey | GYISJMOSWYPXFN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|