C17H25NO3 — CID 114459822
6-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 114459822) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 114459822 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 6-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)(C)C1=CCN(C(=O)C2CC=CCC2C(=O)O)CC1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)12-8-10-18(11-9-12)15(19)13-6-4-5-7-14(13)16(20)21/h4-5,8,13-14H,6-7,9-11H2,1-3H3,(H,20,21) |
| InChIKey | BICKEHJHBMSFDA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|