C12H16ClFN2O4S2 — CID 110819028
1-(5-chloro-2-fluorophenyl)sulfonyl-4-ethylsulfonylpiperazine (PubChem CID 110819028) has the molecular formula C12H16ClFN2O4S2 and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)sulfonyl-4-ethylsulfonylpiperazine.
| Compound Name | 1-(5-chloro-2-fluorophenyl)sulfonyl-4-ethylsulfonylpiperazine |
|---|---|
| PubChem CID | 110819028 |
| Molecular Formula | C12H16ClFN2O4S2 |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)sulfonyl-4-ethylsulfonylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C12H16ClFN2O4S2/c1-2-21(17,18)15-5-7-16(8-6-15)22(19,20)12-9-10(13)3-4-11(12)14/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | FUHNOBUPQTVANY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |