C16H22F4N2O4S2 — CID 86937189
1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-pentylsulfonylpiperazine (PubChem CID 86937189) has the molecular formula C16H22F4N2O4S2 and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-pentylsulfonylpiperazine.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-pentylsulfonylpiperazine |
|---|---|
| PubChem CID | 86937189 |
| Molecular Formula | C16H22F4N2O4S2 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-pentylsulfonylpiperazine |
| SMILES | CCCCCS(=O)(=O)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C16H22F4N2O4S2/c1-2-3-4-11-27(23,24)21-7-9-22(10-8-21)28(25,26)15-12-13(16(18,19)20)5-6-14(15)17/h5-6,12H,2-4,7-11H2,1H3 |
| InChIKey | MWCQINGNAVBISX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|