C19H25F3N4O3S — CID 86936879
5-[(4-pentylsulfonylpiperazin-1-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 86936879) has the molecular formula C19H25F3N4O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 5-[(4-pentylsulfonylpiperazin-1-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[(4-pentylsulfonylpiperazin-1-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 86936879 |
| Molecular Formula | C19H25F3N4O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-[(4-pentylsulfonylpiperazin-1-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCCS(=O)(=O)N1CCN(Cc2nc(-c3ccc(C(F)(F)F)cc3)no2)CC1 |
| InChI | InChI=1S/C19H25F3N4O3S/c1-2-3-4-13-30(27,28)26-11-9-25(10-12-26)14-17-23-18(24-29-17)15-5-7-16(8-6-15)19(20,21)22/h5-8H,2-4,9-14H2,1H3 |
| InChIKey | GZXFPDSQMNHTCH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|