C16H12F6N6O — CID 155948405
5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 155948405) has the molecular formula C16H12F6N6O and a molecular weight of 418.30 g/mol. Its IUPAC name is 5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155948405 |
| Molecular Formula | C16H12F6N6O |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(-c2noc(CN3CCn4c(nnc4C(F)(F)F)C3)n2)cc1 |
| InChI | InChI=1S/C16H12F6N6O/c17-15(18,19)10-3-1-9(2-4-10)13-23-12(29-26-13)8-27-5-6-28-11(7-27)24-25-14(28)16(20,21)22/h1-4H,5-8H2 |
| InChIKey | KNJKGXJSSWMMGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |