C21H29N5O3S — CID 56586934
5-[4-[3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propyl]piperazin-1-yl]sulfonylpentanenitrile (PubChem CID 56586934) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 5-[4-[3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propyl]piperazin-1-yl]sulfonylpentanenitrile.
| Compound Name | 5-[4-[3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propyl]piperazin-1-yl]sulfonylpentanenitrile |
|---|---|
| PubChem CID | 56586934 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 5-[4-[3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propyl]piperazin-1-yl]sulfonylpentanenitrile |
| SMILES | Cc1ccc(-c2noc(CCCN3CCN(S(=O)(=O)CCCCC#N)CC3)n2)cc1 |
| InChI | InChI=1S/C21H29N5O3S/c1-18-7-9-19(10-8-18)21-23-20(29-24-21)6-5-12-25-13-15-26(16-14-25)30(27,28)17-4-2-3-11-22/h7-10H,2-6,12-17H2,1H3 |
| InChIKey | MAYOXNZURSOWJW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|