C12H13F4NO2S — CID 10566988
1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 10566988) has the molecular formula C12H13F4NO2S and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 10566988 |
| Molecular Formula | C12H13F4NO2S |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1F)N1CCCCC1 |
| InChI | InChI=1S/C12H13F4NO2S/c13-10-5-4-9(12(14,15)16)8-11(10)20(18,19)17-6-2-1-3-7-17/h4-5,8H,1-3,6-7H2 |
| InChIKey | GPVAKQNBUQOZHY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |