C21H22N4O5S — CID 154725015
[4-(4-amino-3-hydroxynaphthalen-1-yl)sulfonylpiperazin-1-yl]-(5-amino-2-hydroxyphenyl)methanone (PubChem CID 154725015) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is [4-(4-amino-3-hydroxynaphthalen-1-yl)sulfonylpiperazin-1-yl]-(5-amino-2-hydroxyphenyl)methanone.
| Compound Name | [4-(4-amino-3-hydroxynaphthalen-1-yl)sulfonylpiperazin-1-yl]-(5-amino-2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 154725015 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [4-(4-amino-3-hydroxynaphthalen-1-yl)sulfonylpiperazin-1-yl]-(5-amino-2-hydroxyphenyl)methanone |
| SMILES | Nc1ccc(O)c(C(=O)N2CCN(S(=O)(=O)c3cc(O)c(N)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C21H22N4O5S/c22-13-5-6-17(26)16(11-13)21(28)24-7-9-25(10-8-24)31(29,30)19-12-18(27)20(23)15-4-2-1-3-14(15)19/h1-6,11-12,26-27H,7-10,22-23H2 |
| InChIKey | JAAKRNZDBMWFIB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 150.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|