C12H18N4O4S — CID 61140082
4-(5-amino-2-methoxybenzoyl)piperazine-1-sulfonamide (PubChem CID 61140082) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-(5-amino-2-methoxybenzoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(5-amino-2-methoxybenzoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61140082 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(5-amino-2-methoxybenzoyl)piperazine-1-sulfonamide |
| SMILES | COc1ccc(N)cc1C(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C12H18N4O4S/c1-20-11-3-2-9(13)8-10(11)12(17)15-4-6-16(7-5-15)21(14,18)19/h2-3,8H,4-7,13H2,1H3,(H2,14,18,19) |
| InChIKey | YAWLVAMTMPYJCR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|