C12H17FN4O3S — CID 103296196
4-(5-amino-2-fluoro-3-methylbenzoyl)piperazine-1-sulfonamide (PubChem CID 103296196) has the molecular formula C12H17FN4O3S and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(5-amino-2-fluoro-3-methylbenzoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(5-amino-2-fluoro-3-methylbenzoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 103296196 |
| Molecular Formula | C12H17FN4O3S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(5-amino-2-fluoro-3-methylbenzoyl)piperazine-1-sulfonamide |
| SMILES | Cc1cc(N)cc(C(=O)N2CCN(S(N)(=O)=O)CC2)c1F |
| InChI | InChI=1S/C12H17FN4O3S/c1-8-6-9(14)7-10(11(8)13)12(18)16-2-4-17(5-3-16)21(15,19)20/h6-7H,2-5,14H2,1H3,(H2,15,19,20) |
| InChIKey | FNYBBFNREYGWMK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|