C13H15F3N2O4S — CID 123521313
4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carboxylic acid (PubChem CID 123521313) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carboxylic acid.
| Compound Name | 4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 123521313 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carboxylic acid |
| SMILES | Cc1ccc(C(F)(F)F)cc1S(=O)(=O)N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C13H15F3N2O4S/c1-9-2-3-10(13(14,15)16)8-11(9)23(21,22)18-6-4-17(5-7-18)12(19)20/h2-3,8H,4-7H2,1H3,(H,19,20) |
| InChIKey | LCADBYUPYXRZNM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |