C17H23F3N2O2S — CID 119987410
N-(cyclopropylmethyl)-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine (PubChem CID 119987410) has the molecular formula C17H23F3N2O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 119987410 |
| Molecular Formula | C17H23F3N2O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[2-methyl-5-(trifluoromethyl)phenyl]sulfonylpiperidin-4-amine |
| SMILES | Cc1ccc(C(F)(F)F)cc1S(=O)(=O)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C17H23F3N2O2S/c1-12-2-5-14(17(18,19)20)10-16(12)25(23,24)22-8-6-15(7-9-22)21-11-13-3-4-13/h2,5,10,13,15,21H,3-4,6-9,11H2,1H3 |
| InChIKey | PMOZNTHJJBNCHA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |