C23H42N4O2S — CID 177052719
tert-butyl 4-[1-(4-aminophenyl)sulfanylpiperidin-4-yl]piperazine-1-carboxylate;ethane;methane (PubChem CID 177052719) has the molecular formula C23H42N4O2S and a molecular weight of 438.68 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-aminophenyl)sulfanylpiperidin-4-yl]piperazine-1-carboxylate;ethane;methane.
| Compound Name | tert-butyl 4-[1-(4-aminophenyl)sulfanylpiperidin-4-yl]piperazine-1-carboxylate;ethane;methane |
|---|---|
| PubChem CID | 177052719 |
| Molecular Formula | C23H42N4O2S |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | tert-butyl 4-[1-(4-aminophenyl)sulfanylpiperidin-4-yl]piperazine-1-carboxylate;ethane;methane |
| SMILES | C.CC.CC(C)(C)OC(=O)N1CCN(C2CCN(Sc3ccc(N)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H32N4O2S.C2H6.CH4/c1-20(2,3)26-19(25)23-14-12-22(13-15-23)17-8-10-24(11-9-17)27-18-6-4-16(21)5-7-18;1-2;/h4-7,17H,8-15,21H2,1-3H3;1-2H3;1H4 |
| InChIKey | ONRBQVJXJZRZDV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|