C14H27N3O2 — CID 129462828
tert-butyl 4-[(1R,2R)-2-aminocyclopentyl]piperazine-1-carboxylate (PubChem CID 129462828) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is tert-butyl 4-[(1R,2R)-2-aminocyclopentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1R,2R)-2-aminocyclopentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129462828 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | tert-butyl 4-[(1R,2R)-2-aminocyclopentyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H]2CCC[C@H]2N)CC1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,3)19-13(18)17-9-7-16(8-10-17)12-6-4-5-11(12)15/h11-12H,4-10,15H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | CPAAPDJHETXHGX-VXGBXAGGSA-N |
| XLogP | 1.42 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |