C20H38N4O2 — CID 82565214
tert-butyl 4-[4-(piperidin-1-ylmethyl)piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 82565214) has the molecular formula C20H38N4O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is tert-butyl 4-[4-(piperidin-1-ylmethyl)piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(piperidin-1-ylmethyl)piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 82565214 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | tert-butyl 4-[4-(piperidin-1-ylmethyl)piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CNCCC2CN2CCCCC2)CC1 |
| InChI | InChI=1S/C20H38N4O2/c1-20(2,3)26-19(25)24-13-11-23(12-14-24)18-15-21-8-7-17(18)16-22-9-5-4-6-10-22/h17-18,21H,4-16H2,1-3H3 |
| InChIKey | UIQKWDXLICXBFF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |